About 2-(N'-propylcarbamimidoyl)butanamide
2-(N'-propylcarbamimidoyl)butanamide (PubChem CID 87476604) has the molecular formula C8H17N3O
and a molecular weight of 171.24 g/mol. Its IUPAC name is 2-(N'-propylcarbamimidoyl)butanamide.
Molecular Properties
| Compound Name | 2-(N'-propylcarbamimidoyl)butanamide |
| PubChem CID | 87476604 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | 2-(N'-propylcarbamimidoyl)butanamide |
| SMILES | CCC/N=C(\N)C(CC)C(N)=O |
| InChI | InChI=1S/C8H17N3O/c1-3-5-11-7(9)6(4-2)8(10)12/h6H,3-5H2,1-2H3,(H2,9,11)(H2,10,12) |
| InChIKey | NCDWTUUQGZWUOW-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(N'-propylcarbamimidoyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(N'-propylcarbamimidoyl)butanamide?
The IUPAC name of 2-(N'-propylcarbamimidoyl)butanamide (CID 87476604) is 2-(N'-propylcarbamimidoyl)butanamide.
What is the SMILES notation for 2-(N'-propylcarbamimidoyl)butanamide?
The canonical SMILES for 2-(N'-propylcarbamimidoyl)butanamide is CCC/N=C(\N)C(CC)C(N)=O.
What is the InChIKey of 2-(N'-propylcarbamimidoyl)butanamide?
The InChIKey is NCDWTUUQGZWUOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3O/c1-3-5-11-7(9)6(4-2)8(10)12/h6H,3-5H2,1-2H3,(H2,9,11)(H2,10,12).
What are the key properties of 2-(N'-propylcarbamimidoyl)butanamide?
2-(N'-propylcarbamimidoyl)butanamide has a molecular weight of 171.24 g/mol, XLogP of 0.27, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(N'-propylcarbamimidoyl)butanamide is sourced from PubChem (CID 87476604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).