C24H29ClN8O4S — CID 87476625
N-[(Z)-(5-cyanopyrazolo[1,5-a]pyridin-3-yl)methylideneamino]-N-methyl-2-[methyl(2-piperidin-1-ylethyl)amino]-5-nitrobenzenesulfonamide;hydrochloride (PubChem CID 87476625) has the molecular formula C24H29ClN8O4S and a molecular weight of 561.07 g/mol. Its IUPAC name is N-[(Z)-(5-cyanopyrazolo[1,5-a]pyridin-3-yl)methylideneamino]-N-methyl-2-[methyl(2-piperidin-1-ylethyl)amino]-5-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | N-[(Z)-(5-cyanopyrazolo[1,5-a]pyridin-3-yl)methylideneamino]-N-methyl-2-[methyl(2-piperidin-1-ylethyl)amino]-5-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 87476625 |
| Molecular Formula | C24H29ClN8O4S |
| Molecular Weight | 561.07 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | N-[(Z)-(5-cyanopyrazolo[1,5-a]pyridin-3-yl)methylideneamino]-N-methyl-2-[methyl(2-piperidin-1-ylethyl)amino]-5-nitrobenzenesulfonamide;hydrochloride |
| SMILES | CN(CCN1CCCCC1)c1ccc([N+](=O)[O-])cc1S(=O)(=O)N(C)/N=C\c1cnn2ccc(C#N)cc12.Cl |
| InChI | InChI=1S/C24H28N8O4S.ClH/c1-28(12-13-30-9-4-3-5-10-30)22-7-6-21(32(33)34)15-24(22)37(35,36)29(2)26-17-20-18-27-31-11-8-19(16-25)14-23(20)31;/h6-8,11,14-15,17-18H,3-5,9-10,12-13H2,1-2H3;1H/b26-17-; |
| InChIKey | IAEXNMMWDJJZFR-SJBLSZAKSA-N |
| XLogP | 3.11 |
| TPSA | 140.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.07 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|