About 1,2-bis(trimethylsilyloxy)ethenoxy-trimethylsilane;ethene-1,1-diol
1,2-bis(trimethylsilyloxy)ethenoxy-trimethylsilane;ethene-1,1-diol (PubChem CID 87476834) has the molecular formula C13H32O5Si3
and a molecular weight of 352.65 g/mol. Its IUPAC name is 1,2-bis(trimethylsilyloxy)ethenoxy-trimethylsilane;ethene-1,1-diol.
Molecular Properties
| Compound Name | 1,2-bis(trimethylsilyloxy)ethenoxy-trimethylsilane;ethene-1,1-diol |
| PubChem CID | 87476834 |
| Molecular Formula | C13H32O5Si3 |
| Molecular Weight | 352.65 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 1,2-bis(trimethylsilyloxy)ethenoxy-trimethylsilane;ethene-1,1-diol |
| SMILES | C=C(O)O.C[Si](C)(C)OC=C(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C11H28O3Si3.C2H4O2/c1-15(2,3)12-10-11(13-16(4,5)6)14-17(7,8)9;1-2(3)4/h10H,1-9H3;3-4H,1H2 |
| InChIKey | KBDLJIVAWUDWIW-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.65 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,2-bis(trimethylsilyloxy)ethenoxy-trimethylsilane;ethene-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(trimethylsilyloxy)ethenoxy-trimethylsilane;ethene-1,1-diol?
The IUPAC name of 1,2-bis(trimethylsilyloxy)ethenoxy-trimethylsilane;ethene-1,1-diol (CID 87476834) is 1,2-bis(trimethylsilyloxy)ethenoxy-trimethylsilane;ethene-1,1-diol.
What is the SMILES notation for 1,2-bis(trimethylsilyloxy)ethenoxy-trimethylsilane;ethene-1,1-diol?
The canonical SMILES for 1,2-bis(trimethylsilyloxy)ethenoxy-trimethylsilane;ethene-1,1-diol is C=C(O)O.C[Si](C)(C)OC=C(O[Si](C)(C)C)O[Si](C)(C)C.
What is the InChIKey of 1,2-bis(trimethylsilyloxy)ethenoxy-trimethylsilane;ethene-1,1-diol?
The InChIKey is KBDLJIVAWUDWIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H28O3Si3.C2H4O2/c1-15(2,3)12-10-11(13-16(4,5)6)14-17(7,8)9;1-2(3)4/h10H,1-9H3;3-4H,1H2.
What are the key properties of 1,2-bis(trimethylsilyloxy)ethenoxy-trimethylsilane;ethene-1,1-diol?
1,2-bis(trimethylsilyloxy)ethenoxy-trimethylsilane;ethene-1,1-diol has a molecular weight of 352.65 g/mol, XLogP of 4.91, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(trimethylsilyloxy)ethenoxy-trimethylsilane;ethene-1,1-diol is sourced from PubChem (CID 87476834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).