C13H22S2 — CID 87477033
4,5,6,7,8,9,10,11,12,13-decahydro-3H-cyclododeca[c]dithiole (PubChem CID 87477033) has the molecular formula C13H22S2 and a molecular weight of 242.45 g/mol. Its IUPAC name is 4,5,6,7,8,9,10,11,12,13-decahydro-3H-cyclododeca[c]dithiole.
| Compound Name | 4,5,6,7,8,9,10,11,12,13-decahydro-3H-cyclododeca[c]dithiole |
|---|---|
| PubChem CID | 87477033 |
| Molecular Formula | C13H22S2 |
| Molecular Weight | 242.45 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 4,5,6,7,8,9,10,11,12,13-decahydro-3H-cyclododeca[c]dithiole |
| SMILES | C1CCCCCC2=C(CCCC1)CSS2 |
| InChI | InChI=1S/C13H22S2/c1-2-4-6-8-10-13-12(11-14-15-13)9-7-5-3-1/h1-11H2 |
| InChIKey | RPBLBZKVIZQBSW-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.45 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|