About hydroxy [N'-(2-bicyclo[2.2.1]heptanyl)carbamimidoyl]sulfanylmethanimidate
hydroxy [N'-(2-bicyclo[2.2.1]heptanyl)carbamimidoyl]sulfanylmethanimidate (PubChem CID 87477379) has the molecular formula C9H15N3O2S
and a molecular weight of 229.30 g/mol. Its IUPAC name is hydroxy [N'-(2-bicyclo[2.2.1]heptanyl)carbamimidoyl]sulfanylmethanimidate.
Molecular Properties
| Compound Name | hydroxy [N'-(2-bicyclo[2.2.1]heptanyl)carbamimidoyl]sulfanylmethanimidate |
| PubChem CID | 87477379 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | hydroxy [N'-(2-bicyclo[2.2.1]heptanyl)carbamimidoyl]sulfanylmethanimidate |
| SMILES | [H]/N=C(\OO)S/C(N)=N/C1CC2CCC1C2 |
| InChI | InChI=1S/C9H15N3O2S/c10-8(15-9(11)14-13)12-7-4-5-1-2-6(7)3-5/h5-7,11,13H,1-4H2,(H2,10,12)/b11-9+ |
| InChIKey | BOHTWDAWILFOSZ-PKNBQFBNSA-N |
| XLogP | 1.65 |
| TPSA | 91.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze hydroxy [N'-(2-bicyclo[2.2.1]heptanyl)carbamimidoyl]sulfanylmethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy [N'-(2-bicyclo[2.2.1]heptanyl)carbamimidoyl]sulfanylmethanimidate?
The IUPAC name of hydroxy [N'-(2-bicyclo[2.2.1]heptanyl)carbamimidoyl]sulfanylmethanimidate (CID 87477379) is hydroxy [N'-(2-bicyclo[2.2.1]heptanyl)carbamimidoyl]sulfanylmethanimidate.
What is the SMILES notation for hydroxy [N'-(2-bicyclo[2.2.1]heptanyl)carbamimidoyl]sulfanylmethanimidate?
The canonical SMILES for hydroxy [N'-(2-bicyclo[2.2.1]heptanyl)carbamimidoyl]sulfanylmethanimidate is [H]/N=C(\OO)S/C(N)=N/C1CC2CCC1C2.
What is the InChIKey of hydroxy [N'-(2-bicyclo[2.2.1]heptanyl)carbamimidoyl]sulfanylmethanimidate?
The InChIKey is BOHTWDAWILFOSZ-PKNBQFBNSA-N. The full InChI is InChI=1S/C9H15N3O2S/c10-8(15-9(11)14-13)12-7-4-5-1-2-6(7)3-5/h5-7,11,13H,1-4H2,(H2,10,12)/b11-9+.
What are the key properties of hydroxy [N'-(2-bicyclo[2.2.1]heptanyl)carbamimidoyl]sulfanylmethanimidate?
hydroxy [N'-(2-bicyclo[2.2.1]heptanyl)carbamimidoyl]sulfanylmethanimidate has a molecular weight of 229.30 g/mol, XLogP of 1.65, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy [N'-(2-bicyclo[2.2.1]heptanyl)carbamimidoyl]sulfanylmethanimidate is sourced from PubChem (CID 87477379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).