About 1,2-dihydropyrrol-2-ide;2-ethylcyclopenta-1,3-diene;ruthenium(2+)
1,2-dihydropyrrol-2-ide;2-ethylcyclopenta-1,3-diene;ruthenium(2+) (PubChem CID 87477496) has the molecular formula C11H13NRu
and a molecular weight of 260.30 g/mol. Its IUPAC name is 1,2-dihydropyrrol-2-ide;2-ethylcyclopenta-1,3-diene;ruthenium(2+).
Molecular Properties
| Compound Name | 1,2-dihydropyrrol-2-ide;2-ethylcyclopenta-1,3-diene;ruthenium(2+) |
| PubChem CID | 87477496 |
| Molecular Formula | C11H13NRu |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 1,2-dihydropyrrol-2-ide;2-ethylcyclopenta-1,3-diene;ruthenium(2+) |
| SMILES | CCC1=[C-]CC=C1.[Ru+2].[c-]1ccc[nH]1 |
| InChI | InChI=1S/C7H9.C4H4N.Ru/c1-2-7-5-3-4-6-7;1-2-4-5-3-1;/h3,5H,2,4H2,1H3;1-3,5H;/q2*-1;+2 |
| InChIKey | QOGSIQNQKKLXII-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dihydropyrrol-2-ide;2-ethylcyclopenta-1,3-diene;ruthenium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydropyrrol-2-ide;2-ethylcyclopenta-1,3-diene;ruthenium(2+)?
The IUPAC name of 1,2-dihydropyrrol-2-ide;2-ethylcyclopenta-1,3-diene;ruthenium(2+) (CID 87477496) is 1,2-dihydropyrrol-2-ide;2-ethylcyclopenta-1,3-diene;ruthenium(2+).
What is the SMILES notation for 1,2-dihydropyrrol-2-ide;2-ethylcyclopenta-1,3-diene;ruthenium(2+)?
The canonical SMILES for 1,2-dihydropyrrol-2-ide;2-ethylcyclopenta-1,3-diene;ruthenium(2+) is CCC1=[C-]CC=C1.[Ru+2].[c-]1ccc[nH]1.
What is the InChIKey of 1,2-dihydropyrrol-2-ide;2-ethylcyclopenta-1,3-diene;ruthenium(2+)?
The InChIKey is QOGSIQNQKKLXII-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9.C4H4N.Ru/c1-2-7-5-3-4-6-7;1-2-4-5-3-1;/h3,5H,2,4H2,1H3;1-3,5H;/q2*-1;+2.
What are the key properties of 1,2-dihydropyrrol-2-ide;2-ethylcyclopenta-1,3-diene;ruthenium(2+)?
1,2-dihydropyrrol-2-ide;2-ethylcyclopenta-1,3-diene;ruthenium(2+) has a molecular weight of 260.30 g/mol, XLogP of 2.90, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydropyrrol-2-ide;2-ethylcyclopenta-1,3-diene;ruthenium(2+) is sourced from PubChem (CID 87477496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).