C21H45O21P3S3 — CID 87477569
[(1S,2R,4S,5S)-2,3,4-tris(3-ethylsulfonylpropoxy)-5,6-diphosphonooxycyclohexyl] dihydrogen phosphate (PubChem CID 87477569) has the molecular formula C21H45O21P3S3 and a molecular weight of 822.69 g/mol. Its IUPAC name is [(1S,2R,4S,5S)-2,3,4-tris(3-ethylsulfonylpropoxy)-5,6-diphosphonooxycyclohexyl] dihydrogen phosphate.
| Compound Name | [(1S,2R,4S,5S)-2,3,4-tris(3-ethylsulfonylpropoxy)-5,6-diphosphonooxycyclohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 87477569 |
| Molecular Formula | C21H45O21P3S3 |
| Molecular Weight | 822.69 g/mol |
| Exact Mass | 822.08 |
| IUPAC Name | [(1S,2R,4S,5S)-2,3,4-tris(3-ethylsulfonylpropoxy)-5,6-diphosphonooxycyclohexyl] dihydrogen phosphate |
| SMILES | CCS(=O)(=O)CCCOC1[C@@H](OCCCS(=O)(=O)CC)[C@H](OP(=O)(O)O)C(OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H]1OCCCS(=O)(=O)CC |
| InChI | InChI=1S/C21H45O21P3S3/c1-4-46(31,32)13-7-10-37-16-17(38-11-8-14-47(33,34)5-2)19(40-43(22,23)24)21(42-45(28,29)30)20(41-44(25,26)27)18(16)39-12-9-15-48(35,36)6-3/h16-21H,4-15H2,1-3H3,(H2,22,23,24)(H2,25,26,27)(H2,28,29,30)/t16?,17-,18+,19-,20-,21?/m0/s1 |
| InChIKey | TUUVIKZHUDKARN-UDDZGBILSA-N |
| XLogP | -0.94 |
| TPSA | 330.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.69 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|