About 17,18-dithiabicyclo[14.3.0]nonadec-1(16)-ene
17,18-dithiabicyclo[14.3.0]nonadec-1(16)-ene (PubChem CID 87477651) has the molecular formula C17H30S2
and a molecular weight of 298.56 g/mol. Its IUPAC name is 17,18-dithiabicyclo[14.3.0]nonadec-1(16)-ene.
Molecular Properties
| Compound Name | 17,18-dithiabicyclo[14.3.0]nonadec-1(16)-ene |
| PubChem CID | 87477651 |
| Molecular Formula | C17H30S2 |
| Molecular Weight | 298.56 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 17,18-dithiabicyclo[14.3.0]nonadec-1(16)-ene |
| SMILES | C1CCCCCCCC2=C(CCCCCC1)CSS2 |
| InChI | InChI=1S/C17H30S2/c1-2-4-6-8-10-12-14-17-16(15-18-19-17)13-11-9-7-5-3-1/h1-15H2 |
| InChIKey | NVLJNQGKVQDLLQ-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.56 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 17,18-dithiabicyclo[14.3.0]nonadec-1(16)-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 17,18-dithiabicyclo[14.3.0]nonadec-1(16)-ene?
The IUPAC name of 17,18-dithiabicyclo[14.3.0]nonadec-1(16)-ene (CID 87477651) is 17,18-dithiabicyclo[14.3.0]nonadec-1(16)-ene.
What is the SMILES notation for 17,18-dithiabicyclo[14.3.0]nonadec-1(16)-ene?
The canonical SMILES for 17,18-dithiabicyclo[14.3.0]nonadec-1(16)-ene is C1CCCCCCCC2=C(CCCCCC1)CSS2.
What is the InChIKey of 17,18-dithiabicyclo[14.3.0]nonadec-1(16)-ene?
The InChIKey is NVLJNQGKVQDLLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30S2/c1-2-4-6-8-10-12-14-17-16(15-18-19-17)13-11-9-7-5-3-1/h1-15H2.
What are the key properties of 17,18-dithiabicyclo[14.3.0]nonadec-1(16)-ene?
17,18-dithiabicyclo[14.3.0]nonadec-1(16)-ene has a molecular weight of 298.56 g/mol, XLogP of 7.11, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 17,18-dithiabicyclo[14.3.0]nonadec-1(16)-ene is sourced from PubChem (CID 87477651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).