C8H7F4NO — CID 87477737
3-methyl-6-(1,1,2,2-tetrafluoroethyl)-1H-pyridin-2-one (PubChem CID 87477737) has the molecular formula C8H7F4NO and a molecular weight of 209.14 g/mol. Its IUPAC name is 3-methyl-6-(1,1,2,2-tetrafluoroethyl)-1H-pyridin-2-one.
| Compound Name | 3-methyl-6-(1,1,2,2-tetrafluoroethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 87477737 |
| Molecular Formula | C8H7F4NO |
| Molecular Weight | 209.14 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 3-methyl-6-(1,1,2,2-tetrafluoroethyl)-1H-pyridin-2-one |
| SMILES | Cc1ccc(C(F)(F)C(F)F)[nH]c1=O |
| InChI | InChI=1S/C8H7F4NO/c1-4-2-3-5(13-6(4)14)8(11,12)7(9)10/h2-3,7H,1H3,(H,13,14) |
| InChIKey | MQMBYDLPZXPGRW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.14 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|