About 1-N-[2-(2-aminoethylamino)ethyl]butane-1,2,4-triamine
1-N-[2-(2-aminoethylamino)ethyl]butane-1,2,4-triamine (PubChem CID 87477888) has the molecular formula C8H23N5
and a molecular weight of 189.31 g/mol. Its IUPAC name is 1-N-[2-(2-aminoethylamino)ethyl]butane-1,2,4-triamine.
Molecular Properties
| Compound Name | 1-N-[2-(2-aminoethylamino)ethyl]butane-1,2,4-triamine |
| PubChem CID | 87477888 |
| Molecular Formula | C8H23N5 |
| Molecular Weight | 189.31 g/mol |
| Exact Mass | 189.20 |
| IUPAC Name | 1-N-[2-(2-aminoethylamino)ethyl]butane-1,2,4-triamine |
| SMILES | NCCNCCNCC(N)CCN |
| InChI | InChI=1S/C8H23N5/c9-2-1-8(11)7-13-6-5-12-4-3-10/h8,12-13H,1-7,9-11H2 |
| InChIKey | WZYMYPMHWKEIHN-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.31 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-N-[2-(2-aminoethylamino)ethyl]butane-1,2,4-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-[2-(2-aminoethylamino)ethyl]butane-1,2,4-triamine?
The IUPAC name of 1-N-[2-(2-aminoethylamino)ethyl]butane-1,2,4-triamine (CID 87477888) is 1-N-[2-(2-aminoethylamino)ethyl]butane-1,2,4-triamine.
What is the SMILES notation for 1-N-[2-(2-aminoethylamino)ethyl]butane-1,2,4-triamine?
The canonical SMILES for 1-N-[2-(2-aminoethylamino)ethyl]butane-1,2,4-triamine is NCCNCCNCC(N)CCN.
What is the InChIKey of 1-N-[2-(2-aminoethylamino)ethyl]butane-1,2,4-triamine?
The InChIKey is WZYMYPMHWKEIHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H23N5/c9-2-1-8(11)7-13-6-5-12-4-3-10/h8,12-13H,1-7,9-11H2.
What are the key properties of 1-N-[2-(2-aminoethylamino)ethyl]butane-1,2,4-triamine?
1-N-[2-(2-aminoethylamino)ethyl]butane-1,2,4-triamine has a molecular weight of 189.31 g/mol, XLogP of -2.20, 9 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-[2-(2-aminoethylamino)ethyl]butane-1,2,4-triamine is sourced from PubChem (CID 87477888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).