About (E)-4-butoxy-1,1-difluorobut-3-en-2-one
(E)-4-butoxy-1,1-difluorobut-3-en-2-one (PubChem CID 87477944) has the molecular formula C8H12F2O2
and a molecular weight of 178.18 g/mol. Its IUPAC name is (E)-4-butoxy-1,1-difluorobut-3-en-2-one.
Molecular Properties
| Compound Name | (E)-4-butoxy-1,1-difluorobut-3-en-2-one |
| PubChem CID | 87477944 |
| Molecular Formula | C8H12F2O2 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | (E)-4-butoxy-1,1-difluorobut-3-en-2-one |
| SMILES | CCCCO/C=C/C(=O)C(F)F |
| InChI | InChI=1S/C8H12F2O2/c1-2-3-5-12-6-4-7(11)8(9)10/h4,6,8H,2-3,5H2,1H3/b6-4+ |
| InChIKey | RGRPONOJAUJNSR-GQCTYLIASA-N |
| XLogP | 2.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-butoxy-1,1-difluorobut-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-butoxy-1,1-difluorobut-3-en-2-one?
The IUPAC name of (E)-4-butoxy-1,1-difluorobut-3-en-2-one (CID 87477944) is (E)-4-butoxy-1,1-difluorobut-3-en-2-one.
What is the SMILES notation for (E)-4-butoxy-1,1-difluorobut-3-en-2-one?
The canonical SMILES for (E)-4-butoxy-1,1-difluorobut-3-en-2-one is CCCCO/C=C/C(=O)C(F)F.
What is the InChIKey of (E)-4-butoxy-1,1-difluorobut-3-en-2-one?
The InChIKey is RGRPONOJAUJNSR-GQCTYLIASA-N. The full InChI is InChI=1S/C8H12F2O2/c1-2-3-5-12-6-4-7(11)8(9)10/h4,6,8H,2-3,5H2,1H3/b6-4+.
What are the key properties of (E)-4-butoxy-1,1-difluorobut-3-en-2-one?
(E)-4-butoxy-1,1-difluorobut-3-en-2-one has a molecular weight of 178.18 g/mol, XLogP of 2.15, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-butoxy-1,1-difluorobut-3-en-2-one is sourced from PubChem (CID 87477944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).