About 2,2-bis(2-isocyanatoethyl)-1,3-dithiolane
2,2-bis(2-isocyanatoethyl)-1,3-dithiolane (PubChem CID 87478247) has the molecular formula C9H12N2O2S2
and a molecular weight of 244.34 g/mol. Its IUPAC name is 2,2-bis(2-isocyanatoethyl)-1,3-dithiolane.
Molecular Properties
| Compound Name | 2,2-bis(2-isocyanatoethyl)-1,3-dithiolane |
| PubChem CID | 87478247 |
| Molecular Formula | C9H12N2O2S2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 2,2-bis(2-isocyanatoethyl)-1,3-dithiolane |
| SMILES | O=C=NCCC1(CCN=C=O)SCCS1 |
| InChI | InChI=1S/C9H12N2O2S2/c12-7-10-3-1-9(2-4-11-8-13)14-5-6-15-9/h1-6H2 |
| InChIKey | AGIIOJYSDSINGF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2,2-bis(2-isocyanatoethyl)-1,3-dithiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(2-isocyanatoethyl)-1,3-dithiolane?
The IUPAC name of 2,2-bis(2-isocyanatoethyl)-1,3-dithiolane (CID 87478247) is 2,2-bis(2-isocyanatoethyl)-1,3-dithiolane.
What is the SMILES notation for 2,2-bis(2-isocyanatoethyl)-1,3-dithiolane?
The canonical SMILES for 2,2-bis(2-isocyanatoethyl)-1,3-dithiolane is O=C=NCCC1(CCN=C=O)SCCS1.
What is the InChIKey of 2,2-bis(2-isocyanatoethyl)-1,3-dithiolane?
The InChIKey is AGIIOJYSDSINGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2S2/c12-7-10-3-1-9(2-4-11-8-13)14-5-6-15-9/h1-6H2.
What are the key properties of 2,2-bis(2-isocyanatoethyl)-1,3-dithiolane?
2,2-bis(2-isocyanatoethyl)-1,3-dithiolane has a molecular weight of 244.34 g/mol, XLogP of 1.61, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(2-isocyanatoethyl)-1,3-dithiolane is sourced from PubChem (CID 87478247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).