About N-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chlorophenyl]methyl]-2,2-difluoroethanamine
N-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chlorophenyl]methyl]-2,2-difluoroethanamine (PubChem CID 87478481) has the molecular formula C16H26ClF2NOSi
and a molecular weight of 349.93 g/mol. Its IUPAC name is N-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chlorophenyl]methyl]-2,2-difluoroethanamine.
Molecular Properties
| Compound Name | N-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chlorophenyl]methyl]-2,2-difluoroethanamine |
| PubChem CID | 87478481 |
| Molecular Formula | C16H26ClF2NOSi |
| Molecular Weight | 349.93 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | N-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chlorophenyl]methyl]-2,2-difluoroethanamine |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cc(CNCC(F)F)ccc1Cl |
| InChI | InChI=1S/C16H26ClF2NOSi/c1-16(2,3)22(4,5)21-11-13-8-12(6-7-14(13)17)9-20-10-15(18)19/h6-8,15,20H,9-11H2,1-5H3 |
| InChIKey | QICMHJRPOMENBA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.93 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chlorophenyl]methyl]-2,2-difluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chlorophenyl]methyl]-2,2-difluoroethanamine?
The IUPAC name of N-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chlorophenyl]methyl]-2,2-difluoroethanamine (CID 87478481) is N-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chlorophenyl]methyl]-2,2-difluoroethanamine.
What is the SMILES notation for N-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chlorophenyl]methyl]-2,2-difluoroethanamine?
The canonical SMILES for N-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chlorophenyl]methyl]-2,2-difluoroethanamine is CC(C)(C)[Si](C)(C)OCc1cc(CNCC(F)F)ccc1Cl.
What is the InChIKey of N-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chlorophenyl]methyl]-2,2-difluoroethanamine?
The InChIKey is QICMHJRPOMENBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26ClF2NOSi/c1-16(2,3)22(4,5)21-11-13-8-12(6-7-14(13)17)9-20-10-15(18)19/h6-8,15,20H,9-11H2,1-5H3.
What are the key properties of N-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chlorophenyl]methyl]-2,2-difluoroethanamine?
N-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chlorophenyl]methyl]-2,2-difluoroethanamine has a molecular weight of 349.93 g/mol, XLogP of 5.22, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chlorophenyl]methyl]-2,2-difluoroethanamine is sourced from PubChem (CID 87478481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).