About 3,5-dihydroxyhepta-1,6-dien-4-one
3,5-dihydroxyhepta-1,6-dien-4-one (PubChem CID 87478670) has the molecular formula C7H10O3
and a molecular weight of 142.15 g/mol. Its IUPAC name is 3,5-dihydroxyhepta-1,6-dien-4-one.
Molecular Properties
| Compound Name | 3,5-dihydroxyhepta-1,6-dien-4-one |
| PubChem CID | 87478670 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 3,5-dihydroxyhepta-1,6-dien-4-one |
| SMILES | C=CC(O)C(=O)C(O)C=C |
| InChI | InChI=1S/C7H10O3/c1-3-5(8)7(10)6(9)4-2/h3-6,8-9H,1-2H2 |
| InChIKey | KAQLIALCKXWHNV-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dihydroxyhepta-1,6-dien-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dihydroxyhepta-1,6-dien-4-one?
The IUPAC name of 3,5-dihydroxyhepta-1,6-dien-4-one (CID 87478670) is 3,5-dihydroxyhepta-1,6-dien-4-one.
What is the SMILES notation for 3,5-dihydroxyhepta-1,6-dien-4-one?
The canonical SMILES for 3,5-dihydroxyhepta-1,6-dien-4-one is C=CC(O)C(=O)C(O)C=C.
What is the InChIKey of 3,5-dihydroxyhepta-1,6-dien-4-one?
The InChIKey is KAQLIALCKXWHNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3/c1-3-5(8)7(10)6(9)4-2/h3-6,8-9H,1-2H2.
What are the key properties of 3,5-dihydroxyhepta-1,6-dien-4-one?
3,5-dihydroxyhepta-1,6-dien-4-one has a molecular weight of 142.15 g/mol, XLogP of -0.35, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dihydroxyhepta-1,6-dien-4-one is sourced from PubChem (CID 87478670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).