C25H24NO8PS2 — CID 87478995
3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;2-dimethoxyphosphinothioylsulfanyl-N-methylacetamide (PubChem CID 87478995) has the molecular formula C25H24NO8PS2 and a molecular weight of 561.57 g/mol. Its IUPAC name is 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;2-dimethoxyphosphinothioylsulfanyl-N-methylacetamide.
| Compound Name | 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;2-dimethoxyphosphinothioylsulfanyl-N-methylacetamide |
|---|---|
| PubChem CID | 87478995 |
| Molecular Formula | C25H24NO8PS2 |
| Molecular Weight | 561.57 g/mol |
| Exact Mass | 561.07 |
| IUPAC Name | 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;2-dimethoxyphosphinothioylsulfanyl-N-methylacetamide |
| SMILES | CNC(=O)CSP(=S)(OC)OC.O=C1OC2(c3ccc(O)cc3Oc3cc(O)ccc32)c2ccccc21 |
| InChI | InChI=1S/C20H12O5.C5H12NO3PS2/c21-11-5-7-15-17(9-11)24-18-10-12(22)6-8-16(18)20(15)14-4-2-1-3-13(14)19(23)25-20;1-6-5(7)4-12-10(11,8-2)9-3/h1-10,21-22H;4H2,1-3H3,(H,6,7) |
| InChIKey | FIFXSLMNJAREHT-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|