About [[(2R)-2-amino-3-[(2,3-diamino-3-oxopropyl)disulfanyl]propanoyl]amino]methylphosphonic acid
[[(2R)-2-amino-3-[(2,3-diamino-3-oxopropyl)disulfanyl]propanoyl]amino]methylphosphonic acid (PubChem CID 87479463) has the molecular formula C7H17N4O5PS2
and a molecular weight of 332.34 g/mol. Its IUPAC name is [[(2R)-2-amino-3-[(2,3-diamino-3-oxopropyl)disulfanyl]propanoyl]amino]methylphosphonic acid.
Molecular Properties
| Compound Name | [[(2R)-2-amino-3-[(2,3-diamino-3-oxopropyl)disulfanyl]propanoyl]amino]methylphosphonic acid |
| PubChem CID | 87479463 |
| Molecular Formula | C7H17N4O5PS2 |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | [[(2R)-2-amino-3-[(2,3-diamino-3-oxopropyl)disulfanyl]propanoyl]amino]methylphosphonic acid |
| SMILES | NC(=O)C(N)CSSC[C@H](N)C(=O)NCP(=O)(O)O |
| InChI | InChI=1S/C7H17N4O5PS2/c8-4(6(10)12)1-18-19-2-5(9)7(13)11-3-17(14,15)16/h4-5H,1-3,8-9H2,(H2,10,12)(H,11,13)(H2,14,15,16)/t4?,5-/m0/s1 |
| InChIKey | KVYGEGDJADCGNH-AKGZTFGVSA-N |
| XLogP | -2.24 |
| TPSA | 181.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [[(2R)-2-amino-3-[(2,3-diamino-3-oxopropyl)disulfanyl]propanoyl]amino]methylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(2R)-2-amino-3-[(2,3-diamino-3-oxopropyl)disulfanyl]propanoyl]amino]methylphosphonic acid?
The IUPAC name of [[(2R)-2-amino-3-[(2,3-diamino-3-oxopropyl)disulfanyl]propanoyl]amino]methylphosphonic acid (CID 87479463) is [[(2R)-2-amino-3-[(2,3-diamino-3-oxopropyl)disulfanyl]propanoyl]amino]methylphosphonic acid.
What is the SMILES notation for [[(2R)-2-amino-3-[(2,3-diamino-3-oxopropyl)disulfanyl]propanoyl]amino]methylphosphonic acid?
The canonical SMILES for [[(2R)-2-amino-3-[(2,3-diamino-3-oxopropyl)disulfanyl]propanoyl]amino]methylphosphonic acid is NC(=O)C(N)CSSC[C@H](N)C(=O)NCP(=O)(O)O.
What is the InChIKey of [[(2R)-2-amino-3-[(2,3-diamino-3-oxopropyl)disulfanyl]propanoyl]amino]methylphosphonic acid?
The InChIKey is KVYGEGDJADCGNH-AKGZTFGVSA-N. The full InChI is InChI=1S/C7H17N4O5PS2/c8-4(6(10)12)1-18-19-2-5(9)7(13)11-3-17(14,15)16/h4-5H,1-3,8-9H2,(H2,10,12)(H,11,13)(H2,14,15,16)/t4?,5-/m0/s1.
What are the key properties of [[(2R)-2-amino-3-[(2,3-diamino-3-oxopropyl)disulfanyl]propanoyl]amino]methylphosphonic acid?
[[(2R)-2-amino-3-[(2,3-diamino-3-oxopropyl)disulfanyl]propanoyl]amino]methylphosphonic acid has a molecular weight of 332.34 g/mol, XLogP of -2.24, 9 rotatable bonds, 6 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [[(2R)-2-amino-3-[(2,3-diamino-3-oxopropyl)disulfanyl]propanoyl]amino]methylphosphonic acid is sourced from PubChem (CID 87479463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).