C15H16ClN3O4 — CID 87479695
2-[[1-[(6-chloro-3-pyridinyl)methyl]pyrazol-4-yl]methyl]-2-ethylpropanedioic acid (PubChem CID 87479695) has the molecular formula C15H16ClN3O4 and a molecular weight of 337.76 g/mol. Its IUPAC name is 2-[[1-[(6-chloro-3-pyridinyl)methyl]pyrazol-4-yl]methyl]-2-ethylpropanedioic acid.
| Compound Name | 2-[[1-[(6-chloro-3-pyridinyl)methyl]pyrazol-4-yl]methyl]-2-ethylpropanedioic acid |
|---|---|
| PubChem CID | 87479695 |
| Molecular Formula | C15H16ClN3O4 |
| Molecular Weight | 337.76 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 2-[[1-[(6-chloro-3-pyridinyl)methyl]pyrazol-4-yl]methyl]-2-ethylpropanedioic acid |
| SMILES | CCC(Cc1cnn(Cc2ccc(Cl)nc2)c1)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C15H16ClN3O4/c1-2-15(13(20)21,14(22)23)5-11-7-18-19(9-11)8-10-3-4-12(16)17-6-10/h3-4,6-7,9H,2,5,8H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | QLIRGQWNDGILLM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.76 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|