About azane;3-chloro-3-[(Z)-octadec-9-enyl]pentane-1,5-diol
azane;3-chloro-3-[(Z)-octadec-9-enyl]pentane-1,5-diol (PubChem CID 87479871) has the molecular formula C23H48ClNO2
and a molecular weight of 406.10 g/mol. Its IUPAC name is azane;3-chloro-3-[(Z)-octadec-9-enyl]pentane-1,5-diol.
Molecular Properties
| Compound Name | azane;3-chloro-3-[(Z)-octadec-9-enyl]pentane-1,5-diol |
| PubChem CID | 87479871 |
| Molecular Formula | C23H48ClNO2 |
| Molecular Weight | 406.10 g/mol |
| Exact Mass | 405.34 |
| IUPAC Name | azane;3-chloro-3-[(Z)-octadec-9-enyl]pentane-1,5-diol |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC(Cl)(CCO)CCO.N |
| InChI | InChI=1S/C23H45ClO2.H3N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(24,19-21-25)20-22-26;/h9-10,25-26H,2-8,11-22H2,1H3;1H3/b10-9-; |
| InChIKey | RUVFFZRPRYVSAF-KVVVOXFISA-N |
| XLogP | 7.32 |
| TPSA | 75.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.10 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze azane;3-chloro-3-[(Z)-octadec-9-enyl]pentane-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3-chloro-3-[(Z)-octadec-9-enyl]pentane-1,5-diol?
The IUPAC name of azane;3-chloro-3-[(Z)-octadec-9-enyl]pentane-1,5-diol (CID 87479871) is azane;3-chloro-3-[(Z)-octadec-9-enyl]pentane-1,5-diol.
What is the SMILES notation for azane;3-chloro-3-[(Z)-octadec-9-enyl]pentane-1,5-diol?
The canonical SMILES for azane;3-chloro-3-[(Z)-octadec-9-enyl]pentane-1,5-diol is CCCCCCCC/C=C\CCCCCCCCC(Cl)(CCO)CCO.N.
What is the InChIKey of azane;3-chloro-3-[(Z)-octadec-9-enyl]pentane-1,5-diol?
The InChIKey is RUVFFZRPRYVSAF-KVVVOXFISA-N. The full InChI is InChI=1S/C23H45ClO2.H3N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(24,19-21-25)20-22-26;/h9-10,25-26H,2-8,11-22H2,1H3;1H3/b10-9-;.
What are the key properties of azane;3-chloro-3-[(Z)-octadec-9-enyl]pentane-1,5-diol?
azane;3-chloro-3-[(Z)-octadec-9-enyl]pentane-1,5-diol has a molecular weight of 406.10 g/mol, XLogP of 7.32, 20 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3-chloro-3-[(Z)-octadec-9-enyl]pentane-1,5-diol is sourced from PubChem (CID 87479871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).