About 2-(2,5-dihydrofuran-2-yl)ethyl-[(2-methylpropan-2-yl)oxy]carbamic acid
2-(2,5-dihydrofuran-2-yl)ethyl-[(2-methylpropan-2-yl)oxy]carbamic acid (PubChem CID 87479915) has the molecular formula C11H19NO4
and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-(2,5-dihydrofuran-2-yl)ethyl-[(2-methylpropan-2-yl)oxy]carbamic acid.
Molecular Properties
| Compound Name | 2-(2,5-dihydrofuran-2-yl)ethyl-[(2-methylpropan-2-yl)oxy]carbamic acid |
| PubChem CID | 87479915 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 2-(2,5-dihydrofuran-2-yl)ethyl-[(2-methylpropan-2-yl)oxy]carbamic acid |
| SMILES | CC(C)(C)ON(CCC1C=CCO1)C(=O)O |
| InChI | InChI=1S/C11H19NO4/c1-11(2,3)16-12(10(13)14)7-6-9-5-4-8-15-9/h4-5,9H,6-8H2,1-3H3,(H,13,14) |
| InChIKey | QAJLEABMUGPDIG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dihydrofuran-2-yl)ethyl-[(2-methylpropan-2-yl)oxy]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dihydrofuran-2-yl)ethyl-[(2-methylpropan-2-yl)oxy]carbamic acid?
The IUPAC name of 2-(2,5-dihydrofuran-2-yl)ethyl-[(2-methylpropan-2-yl)oxy]carbamic acid (CID 87479915) is 2-(2,5-dihydrofuran-2-yl)ethyl-[(2-methylpropan-2-yl)oxy]carbamic acid.
What is the SMILES notation for 2-(2,5-dihydrofuran-2-yl)ethyl-[(2-methylpropan-2-yl)oxy]carbamic acid?
The canonical SMILES for 2-(2,5-dihydrofuran-2-yl)ethyl-[(2-methylpropan-2-yl)oxy]carbamic acid is CC(C)(C)ON(CCC1C=CCO1)C(=O)O.
What is the InChIKey of 2-(2,5-dihydrofuran-2-yl)ethyl-[(2-methylpropan-2-yl)oxy]carbamic acid?
The InChIKey is QAJLEABMUGPDIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO4/c1-11(2,3)16-12(10(13)14)7-6-9-5-4-8-15-9/h4-5,9H,6-8H2,1-3H3,(H,13,14).
What are the key properties of 2-(2,5-dihydrofuran-2-yl)ethyl-[(2-methylpropan-2-yl)oxy]carbamic acid?
2-(2,5-dihydrofuran-2-yl)ethyl-[(2-methylpropan-2-yl)oxy]carbamic acid has a molecular weight of 229.28 g/mol, XLogP of 2.04, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dihydrofuran-2-yl)ethyl-[(2-methylpropan-2-yl)oxy]carbamic acid is sourced from PubChem (CID 87479915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).