About [1-(hydroxymethyl)-2-bicyclo[2.2.1]hept-2-enyl]methanol;bis(4-sulfanylpentanoic acid)
[1-(hydroxymethyl)-2-bicyclo[2.2.1]hept-2-enyl]methanol;bis(4-sulfanylpentanoic acid) (PubChem CID 87480148) has the molecular formula C19H34O6S2
and a molecular weight of 422.61 g/mol. Its IUPAC name is [1-(hydroxymethyl)-2-bicyclo[2.2.1]hept-2-enyl]methanol;bis(4-sulfanylpentanoic acid).
Molecular Properties
| Compound Name | [1-(hydroxymethyl)-2-bicyclo[2.2.1]hept-2-enyl]methanol;bis(4-sulfanylpentanoic acid) |
| PubChem CID | 87480148 |
| Molecular Formula | C19H34O6S2 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | [1-(hydroxymethyl)-2-bicyclo[2.2.1]hept-2-enyl]methanol;bis(4-sulfanylpentanoic acid) |
| SMILES | CC(S)CCC(=O)O.CC(S)CCC(=O)O.OCC1=CC2CCC1(CO)C2 |
| InChI | InChI=1S/C9H14O2.2C5H10O2S/c10-5-8-3-7-1-2-9(8,4-7)6-11;2*1-4(8)2-3-5(6)7/h3,7,10-11H,1-2,4-6H2;2*4,8H,2-3H2,1H3,(H,6,7) |
| InChIKey | MIPPYKDRVJDWNF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [1-(hydroxymethyl)-2-bicyclo[2.2.1]hept-2-enyl]methanol;bis(4-sulfanylpentanoic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(hydroxymethyl)-2-bicyclo[2.2.1]hept-2-enyl]methanol;bis(4-sulfanylpentanoic acid)?
The IUPAC name of [1-(hydroxymethyl)-2-bicyclo[2.2.1]hept-2-enyl]methanol;bis(4-sulfanylpentanoic acid) (CID 87480148) is [1-(hydroxymethyl)-2-bicyclo[2.2.1]hept-2-enyl]methanol;bis(4-sulfanylpentanoic acid).
What is the SMILES notation for [1-(hydroxymethyl)-2-bicyclo[2.2.1]hept-2-enyl]methanol;bis(4-sulfanylpentanoic acid)?
The canonical SMILES for [1-(hydroxymethyl)-2-bicyclo[2.2.1]hept-2-enyl]methanol;bis(4-sulfanylpentanoic acid) is CC(S)CCC(=O)O.CC(S)CCC(=O)O.OCC1=CC2CCC1(CO)C2.
What is the InChIKey of [1-(hydroxymethyl)-2-bicyclo[2.2.1]hept-2-enyl]methanol;bis(4-sulfanylpentanoic acid)?
The InChIKey is MIPPYKDRVJDWNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2.2C5H10O2S/c10-5-8-3-7-1-2-9(8,4-7)6-11;2*1-4(8)2-3-5(6)7/h3,7,10-11H,1-2,4-6H2;2*4,8H,2-3H2,1H3,(H,6,7).
What are the key properties of [1-(hydroxymethyl)-2-bicyclo[2.2.1]hept-2-enyl]methanol;bis(4-sulfanylpentanoic acid)?
[1-(hydroxymethyl)-2-bicyclo[2.2.1]hept-2-enyl]methanol;bis(4-sulfanylpentanoic acid) has a molecular weight of 422.61 g/mol, XLogP of 3.04, 8 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(hydroxymethyl)-2-bicyclo[2.2.1]hept-2-enyl]methanol;bis(4-sulfanylpentanoic acid) is sourced from PubChem (CID 87480148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).