C10H24N4O8P2S2 — CID 87480453
[[(2S)-2-amino-4-[(3,4-diamino-4-oxobutyl)disulfanyl]butanoyl]-(phosphonomethyl)amino]methylphosphonic acid (PubChem CID 87480453) has the molecular formula C10H24N4O8P2S2 and a molecular weight of 454.40 g/mol. Its IUPAC name is [[(2S)-2-amino-4-[(3,4-diamino-4-oxobutyl)disulfanyl]butanoyl]-(phosphonomethyl)amino]methylphosphonic acid.
| Compound Name | [[(2S)-2-amino-4-[(3,4-diamino-4-oxobutyl)disulfanyl]butanoyl]-(phosphonomethyl)amino]methylphosphonic acid |
|---|---|
| PubChem CID | 87480453 |
| Molecular Formula | C10H24N4O8P2S2 |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | [[(2S)-2-amino-4-[(3,4-diamino-4-oxobutyl)disulfanyl]butanoyl]-(phosphonomethyl)amino]methylphosphonic acid |
| SMILES | NC(=O)C(N)CCSSCC[C@H](N)C(=O)N(CP(=O)(O)O)CP(=O)(O)O |
| InChI | InChI=1S/C10H24N4O8P2S2/c11-7(9(13)15)1-3-25-26-4-2-8(12)10(16)14(5-23(17,18)19)6-24(20,21)22/h7-8H,1-6,11-12H2,(H2,13,15)(H2,17,18,19)(H2,20,21,22)/t7?,8-/m0/s1 |
| InChIKey | GIIRHDFKXQVPJR-MQWKRIRWSA-N |
| XLogP | -1.61 |
| TPSA | 230.50 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|