C29H25Cl2F3N2O7S — CID 87480581
[[3-[2-(2,4-dichlorobenzoyl)-3-[(2-methoxyethylamino)methyl]-1-benzofuran-6-yl]phenyl]methyl-methylsulfonylamino] 2,2,2-trifluoroacetate (PubChem CID 87480581) has the molecular formula C29H25Cl2F3N2O7S and a molecular weight of 673.49 g/mol. Its IUPAC name is [[3-[2-(2,4-dichlorobenzoyl)-3-[(2-methoxyethylamino)methyl]-1-benzofuran-6-yl]phenyl]methyl-methylsulfonylamino] 2,2,2-trifluoroacetate.
| Compound Name | [[3-[2-(2,4-dichlorobenzoyl)-3-[(2-methoxyethylamino)methyl]-1-benzofuran-6-yl]phenyl]methyl-methylsulfonylamino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87480581 |
| Molecular Formula | C29H25Cl2F3N2O7S |
| Molecular Weight | 673.49 g/mol |
| Exact Mass | 672.07 |
| IUPAC Name | [[3-[2-(2,4-dichlorobenzoyl)-3-[(2-methoxyethylamino)methyl]-1-benzofuran-6-yl]phenyl]methyl-methylsulfonylamino] 2,2,2-trifluoroacetate |
| SMILES | COCCNCc1c(C(=O)c2ccc(Cl)cc2Cl)oc2cc(-c3cccc(CN(OC(=O)C(F)(F)F)S(C)(=O)=O)c3)ccc12 |
| InChI | InChI=1S/C29H25Cl2F3N2O7S/c1-41-11-10-35-15-23-21-8-6-19(13-25(21)42-27(23)26(37)22-9-7-20(30)14-24(22)31)18-5-3-4-17(12-18)16-36(44(2,39)40)43-28(38)29(32,33)34/h3-9,12-14,35H,10-11,15-16H2,1-2H3 |
| InChIKey | AHIRLPUMDXPOEM-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.49 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|