C8H20N4O8P2S2 — CID 87480694
[[(2R)-2-amino-3-[(2,3-diamino-3-oxopropyl)disulfanyl]propanoyl]-(phosphonomethyl)amino]methylphosphonic acid (PubChem CID 87480694) has the molecular formula C8H20N4O8P2S2 and a molecular weight of 426.35 g/mol. Its IUPAC name is [[(2R)-2-amino-3-[(2,3-diamino-3-oxopropyl)disulfanyl]propanoyl]-(phosphonomethyl)amino]methylphosphonic acid.
| Compound Name | [[(2R)-2-amino-3-[(2,3-diamino-3-oxopropyl)disulfanyl]propanoyl]-(phosphonomethyl)amino]methylphosphonic acid |
|---|---|
| PubChem CID | 87480694 |
| Molecular Formula | C8H20N4O8P2S2 |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | [[(2R)-2-amino-3-[(2,3-diamino-3-oxopropyl)disulfanyl]propanoyl]-(phosphonomethyl)amino]methylphosphonic acid |
| SMILES | NC(=O)C(N)CSSC[C@H](N)C(=O)N(CP(=O)(O)O)CP(=O)(O)O |
| InChI | InChI=1S/C8H20N4O8P2S2/c9-5(7(11)13)1-23-24-2-6(10)8(14)12(3-21(15,16)17)4-22(18,19)20/h5-6H,1-4,9-10H2,(H2,11,13)(H2,15,16,17)(H2,18,19,20)/t5?,6-/m0/s1 |
| InChIKey | GYCQVBCSJNOGKE-GDVGLLTNSA-N |
| XLogP | -2.39 |
| TPSA | 230.50 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|