About [[(2S)-2-amino-4-[(3,4-diamino-4-oxobutyl)disulfanyl]butanoyl]amino]methylphosphonic acid
[[(2S)-2-amino-4-[(3,4-diamino-4-oxobutyl)disulfanyl]butanoyl]amino]methylphosphonic acid (PubChem CID 87480702) has the molecular formula C9H21N4O5PS2
and a molecular weight of 360.40 g/mol. Its IUPAC name is [[(2S)-2-amino-4-[(3,4-diamino-4-oxobutyl)disulfanyl]butanoyl]amino]methylphosphonic acid.
Molecular Properties
| Compound Name | [[(2S)-2-amino-4-[(3,4-diamino-4-oxobutyl)disulfanyl]butanoyl]amino]methylphosphonic acid |
| PubChem CID | 87480702 |
| Molecular Formula | C9H21N4O5PS2 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | [[(2S)-2-amino-4-[(3,4-diamino-4-oxobutyl)disulfanyl]butanoyl]amino]methylphosphonic acid |
| SMILES | NC(=O)C(N)CCSSCC[C@H](N)C(=O)NCP(=O)(O)O |
| InChI | InChI=1S/C9H21N4O5PS2/c10-6(8(12)14)1-3-20-21-4-2-7(11)9(15)13-5-19(16,17)18/h6-7H,1-5,10-11H2,(H2,12,14)(H,13,15)(H2,16,17,18)/t6?,7-/m0/s1 |
| InChIKey | KCIPYPPERPAPQY-MLWJPKLSSA-N |
| XLogP | -1.46 |
| TPSA | 181.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [[(2S)-2-amino-4-[(3,4-diamino-4-oxobutyl)disulfanyl]butanoyl]amino]methylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(2S)-2-amino-4-[(3,4-diamino-4-oxobutyl)disulfanyl]butanoyl]amino]methylphosphonic acid?
The IUPAC name of [[(2S)-2-amino-4-[(3,4-diamino-4-oxobutyl)disulfanyl]butanoyl]amino]methylphosphonic acid (CID 87480702) is [[(2S)-2-amino-4-[(3,4-diamino-4-oxobutyl)disulfanyl]butanoyl]amino]methylphosphonic acid.
What is the SMILES notation for [[(2S)-2-amino-4-[(3,4-diamino-4-oxobutyl)disulfanyl]butanoyl]amino]methylphosphonic acid?
The canonical SMILES for [[(2S)-2-amino-4-[(3,4-diamino-4-oxobutyl)disulfanyl]butanoyl]amino]methylphosphonic acid is NC(=O)C(N)CCSSCC[C@H](N)C(=O)NCP(=O)(O)O.
What is the InChIKey of [[(2S)-2-amino-4-[(3,4-diamino-4-oxobutyl)disulfanyl]butanoyl]amino]methylphosphonic acid?
The InChIKey is KCIPYPPERPAPQY-MLWJPKLSSA-N. The full InChI is InChI=1S/C9H21N4O5PS2/c10-6(8(12)14)1-3-20-21-4-2-7(11)9(15)13-5-19(16,17)18/h6-7H,1-5,10-11H2,(H2,12,14)(H,13,15)(H2,16,17,18)/t6?,7-/m0/s1.
What are the key properties of [[(2S)-2-amino-4-[(3,4-diamino-4-oxobutyl)disulfanyl]butanoyl]amino]methylphosphonic acid?
[[(2S)-2-amino-4-[(3,4-diamino-4-oxobutyl)disulfanyl]butanoyl]amino]methylphosphonic acid has a molecular weight of 360.40 g/mol, XLogP of -1.46, 11 rotatable bonds, 6 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [[(2S)-2-amino-4-[(3,4-diamino-4-oxobutyl)disulfanyl]butanoyl]amino]methylphosphonic acid is sourced from PubChem (CID 87480702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).