About 2-amino-5-phosphorosooxypentanoic acid;azane
2-amino-5-phosphorosooxypentanoic acid;azane (PubChem CID 87481261) has the molecular formula C5H13N2O4P
and a molecular weight of 196.14 g/mol. Its IUPAC name is 2-amino-5-phosphorosooxypentanoic acid;azane.
Molecular Properties
| Compound Name | 2-amino-5-phosphorosooxypentanoic acid;azane |
| PubChem CID | 87481261 |
| Molecular Formula | C5H13N2O4P |
| Molecular Weight | 196.14 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 2-amino-5-phosphorosooxypentanoic acid;azane |
| SMILES | N.NC(CCCOP=O)C(=O)O |
| InChI | InChI=1S/C5H10NO4P.H3N/c6-4(5(7)8)2-1-3-10-11-9;/h4H,1-3,6H2,(H,7,8);1H3 |
| InChIKey | NSQDTXFYNOPKBR-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 124.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.14 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-phosphorosooxypentanoic acid;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-phosphorosooxypentanoic acid;azane?
The IUPAC name of 2-amino-5-phosphorosooxypentanoic acid;azane (CID 87481261) is 2-amino-5-phosphorosooxypentanoic acid;azane.
What is the SMILES notation for 2-amino-5-phosphorosooxypentanoic acid;azane?
The canonical SMILES for 2-amino-5-phosphorosooxypentanoic acid;azane is N.NC(CCCOP=O)C(=O)O.
What is the InChIKey of 2-amino-5-phosphorosooxypentanoic acid;azane?
The InChIKey is NSQDTXFYNOPKBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10NO4P.H3N/c6-4(5(7)8)2-1-3-10-11-9;/h4H,1-3,6H2,(H,7,8);1H3.
What are the key properties of 2-amino-5-phosphorosooxypentanoic acid;azane?
2-amino-5-phosphorosooxypentanoic acid;azane has a molecular weight of 196.14 g/mol, XLogP of 0.56, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-phosphorosooxypentanoic acid;azane is sourced from PubChem (CID 87481261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).