C23H33NO4 — CID 87481373
[(3S,5S,8R,9S,10S,13S,14S,17S)-17-acetyl-3-ethynyl-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] nitrate (PubChem CID 87481373) has the molecular formula C23H33NO4 and a molecular weight of 387.52 g/mol. Its IUPAC name is [(3S,5S,8R,9S,10S,13S,14S,17S)-17-acetyl-3-ethynyl-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] nitrate.
| Compound Name | [(3S,5S,8R,9S,10S,13S,14S,17S)-17-acetyl-3-ethynyl-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] nitrate |
|---|---|
| PubChem CID | 87481373 |
| Molecular Formula | C23H33NO4 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | [(3S,5S,8R,9S,10S,13S,14S,17S)-17-acetyl-3-ethynyl-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] nitrate |
| SMILES | C#C[C@]1(O[N+](=O)[O-])CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H](C(C)=O)CC[C@@H]32)C1 |
| InChI | InChI=1S/C23H33NO4/c1-5-23(28-24(26)27)13-12-21(3)16(14-23)6-7-17-19-9-8-18(15(2)25)22(19,4)11-10-20(17)21/h1,16-20H,6-14H2,2-4H3/t16-,17-,18+,19-,20-,21-,22+,23-/m0/s1 |
| InChIKey | LDRDZHFCBUCTHH-DAEVNGOHSA-N |
| XLogP | 4.81 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|