C6H8F6O — CID 87481869
1,2,3,4,5,6-hexafluorohexan-1-ol (PubChem CID 87481869) has the molecular formula C6H8F6O and a molecular weight of 210.12 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexafluorohexan-1-ol.
| Compound Name | 1,2,3,4,5,6-hexafluorohexan-1-ol |
|---|---|
| PubChem CID | 87481869 |
| Molecular Formula | C6H8F6O |
| Molecular Weight | 210.12 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 1,2,3,4,5,6-hexafluorohexan-1-ol |
| SMILES | OC(F)C(F)C(F)C(F)C(F)CF |
| InChI | InChI=1S/C6H8F6O/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-6,13H,1H2 |
| InChIKey | YAXGKHUPVHESAW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.12 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |