About 1-O-tert-butyl 6-O-methyl 2-methylidenehexanedioate
1-O-tert-butyl 6-O-methyl 2-methylidenehexanedioate (PubChem CID 87482208) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is 1-O-tert-butyl 6-O-methyl 2-methylidenehexanedioate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 6-O-methyl 2-methylidenehexanedioate |
| PubChem CID | 87482208 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 1-O-tert-butyl 6-O-methyl 2-methylidenehexanedioate |
| SMILES | C=C(CCCC(=O)OC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H20O4/c1-9(7-6-8-10(13)15-5)11(14)16-12(2,3)4/h1,6-8H2,2-5H3 |
| InChIKey | MJEJLALJUHZJNF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-O-tert-butyl 6-O-methyl 2-methylidenehexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 6-O-methyl 2-methylidenehexanedioate?
The IUPAC name of 1-O-tert-butyl 6-O-methyl 2-methylidenehexanedioate (CID 87482208) is 1-O-tert-butyl 6-O-methyl 2-methylidenehexanedioate.
What is the SMILES notation for 1-O-tert-butyl 6-O-methyl 2-methylidenehexanedioate?
The canonical SMILES for 1-O-tert-butyl 6-O-methyl 2-methylidenehexanedioate is C=C(CCCC(=O)OC)C(=O)OC(C)(C)C.
What is the InChIKey of 1-O-tert-butyl 6-O-methyl 2-methylidenehexanedioate?
The InChIKey is MJEJLALJUHZJNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4/c1-9(7-6-8-10(13)15-5)11(14)16-12(2,3)4/h1,6-8H2,2-5H3.
What are the key properties of 1-O-tert-butyl 6-O-methyl 2-methylidenehexanedioate?
1-O-tert-butyl 6-O-methyl 2-methylidenehexanedioate has a molecular weight of 228.29 g/mol, XLogP of 2.23, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 6-O-methyl 2-methylidenehexanedioate is sourced from PubChem (CID 87482208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).