C8H28N10 — CID 87482541
1-N",1-N"-diamino-2-N'-[2-[2-(2-aminoethylamino)ethylamino]ethyl]ethane-1,1,1,2,2-pentamine (PubChem CID 87482541) has the molecular formula C8H28N10 and a molecular weight of 264.38 g/mol. Its IUPAC name is 1-N",1-N"-diamino-2-N'-[2-[2-(2-aminoethylamino)ethylamino]ethyl]ethane-1,1,1,2,2-pentamine.
| Compound Name | 1-N",1-N"-diamino-2-N'-[2-[2-(2-aminoethylamino)ethylamino]ethyl]ethane-1,1,1,2,2-pentamine |
|---|---|
| PubChem CID | 87482541 |
| Molecular Formula | C8H28N10 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.25 |
| IUPAC Name | 1-N",1-N"-diamino-2-N'-[2-[2-(2-aminoethylamino)ethylamino]ethyl]ethane-1,1,1,2,2-pentamine |
| SMILES | NCCNCCNCCNC(N)C(N)(N)N(N)N |
| InChI | InChI=1S/C8H28N10/c9-1-2-15-3-4-16-5-6-17-7(10)8(11,12)18(13)14/h7,15-17H,1-6,9-14H2 |
| InChIKey | JDVJPKVUIJHNEC-UHFFFAOYSA-N |
| XLogP | -5.38 |
| TPSA | 195.45 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | -5.38 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|