C19H17NO4S2 — CID 87482635
3-[(5E)-4-oxo-5-[(5-phenylfuran-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]propyl acetate (PubChem CID 87482635) has the molecular formula C19H17NO4S2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 3-[(5E)-4-oxo-5-[(5-phenylfuran-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]propyl acetate.
| Compound Name | 3-[(5E)-4-oxo-5-[(5-phenylfuran-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]propyl acetate |
|---|---|
| PubChem CID | 87482635 |
| Molecular Formula | C19H17NO4S2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 3-[(5E)-4-oxo-5-[(5-phenylfuran-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]propyl acetate |
| SMILES | CC(=O)OCCCN1C(=O)/C(=C\c2ccc(-c3ccccc3)o2)SC1=S |
| InChI | InChI=1S/C19H17NO4S2/c1-13(21)23-11-5-10-20-18(22)17(26-19(20)25)12-15-8-9-16(24-15)14-6-3-2-4-7-14/h2-4,6-9,12H,5,10-11H2,1H3/b17-12+ |
| InChIKey | JUXAFXSYZIZAOR-SFQUDFHCSA-N |
| XLogP | 4.10 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|