About azane;4-chloro-6-[4-[[2-(trifluoromethyl)-4-pyridinyl]oxy]phenyl]pyrimidin-2-amine
azane;4-chloro-6-[4-[[2-(trifluoromethyl)-4-pyridinyl]oxy]phenyl]pyrimidin-2-amine (PubChem CID 87482654) has the molecular formula C16H13ClF3N5O
and a molecular weight of 383.76 g/mol. Its IUPAC name is azane;4-chloro-6-[4-[[2-(trifluoromethyl)-4-pyridinyl]oxy]phenyl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | azane;4-chloro-6-[4-[[2-(trifluoromethyl)-4-pyridinyl]oxy]phenyl]pyrimidin-2-amine |
| PubChem CID | 87482654 |
| Molecular Formula | C16H13ClF3N5O |
| Molecular Weight | 383.76 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | azane;4-chloro-6-[4-[[2-(trifluoromethyl)-4-pyridinyl]oxy]phenyl]pyrimidin-2-amine |
| SMILES | N.Nc1nc(Cl)cc(-c2ccc(Oc3ccnc(C(F)(F)F)c3)cc2)n1 |
| InChI | InChI=1S/C16H10ClF3N4O.H3N/c17-14-8-12(23-15(21)24-14)9-1-3-10(4-2-9)25-11-5-6-22-13(7-11)16(18,19)20;/h1-8H,(H2,21,23,24);1H3 |
| InChIKey | ULSZWGXNYSQSNC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.76 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze azane;4-chloro-6-[4-[[2-(trifluoromethyl)-4-pyridinyl]oxy]phenyl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;4-chloro-6-[4-[[2-(trifluoromethyl)-4-pyridinyl]oxy]phenyl]pyrimidin-2-amine?
The IUPAC name of azane;4-chloro-6-[4-[[2-(trifluoromethyl)-4-pyridinyl]oxy]phenyl]pyrimidin-2-amine (CID 87482654) is azane;4-chloro-6-[4-[[2-(trifluoromethyl)-4-pyridinyl]oxy]phenyl]pyrimidin-2-amine.
What is the SMILES notation for azane;4-chloro-6-[4-[[2-(trifluoromethyl)-4-pyridinyl]oxy]phenyl]pyrimidin-2-amine?
The canonical SMILES for azane;4-chloro-6-[4-[[2-(trifluoromethyl)-4-pyridinyl]oxy]phenyl]pyrimidin-2-amine is N.Nc1nc(Cl)cc(-c2ccc(Oc3ccnc(C(F)(F)F)c3)cc2)n1.
What is the InChIKey of azane;4-chloro-6-[4-[[2-(trifluoromethyl)-4-pyridinyl]oxy]phenyl]pyrimidin-2-amine?
The InChIKey is ULSZWGXNYSQSNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10ClF3N4O.H3N/c17-14-8-12(23-15(21)24-14)9-1-3-10(4-2-9)25-11-5-6-22-13(7-11)16(18,19)20;/h1-8H,(H2,21,23,24);1H3.
What are the key properties of azane;4-chloro-6-[4-[[2-(trifluoromethyl)-4-pyridinyl]oxy]phenyl]pyrimidin-2-amine?
azane;4-chloro-6-[4-[[2-(trifluoromethyl)-4-pyridinyl]oxy]phenyl]pyrimidin-2-amine has a molecular weight of 383.76 g/mol, XLogP of 4.75, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4-chloro-6-[4-[[2-(trifluoromethyl)-4-pyridinyl]oxy]phenyl]pyrimidin-2-amine is sourced from PubChem (CID 87482654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).