C62H52N2O6Zn — CID 87482880
zinc bis(3-[1-(4-phenoxyphenyl)-3-(2-phenylethyl)indol-5-yl]propanoate) (PubChem CID 87482880) has the molecular formula C62H52N2O6Zn and a molecular weight of 986.50 g/mol. Its IUPAC name is zinc bis(3-[1-(4-phenoxyphenyl)-3-(2-phenylethyl)indol-5-yl]propanoate).
| Compound Name | zinc bis(3-[1-(4-phenoxyphenyl)-3-(2-phenylethyl)indol-5-yl]propanoate) |
|---|---|
| PubChem CID | 87482880 |
| Molecular Formula | C62H52N2O6Zn |
| Molecular Weight | 986.50 g/mol |
| Exact Mass | 984.31 |
| IUPAC Name | zinc bis(3-[1-(4-phenoxyphenyl)-3-(2-phenylethyl)indol-5-yl]propanoate) |
| SMILES | O=C([O-])CCc1ccc2c(c1)c(CCc1ccccc1)cn2-c1ccc(Oc2ccccc2)cc1.O=C([O-])CCc1ccc2c(c1)c(CCc1ccccc1)cn2-c1ccc(Oc2ccccc2)cc1.[Zn+2] |
| InChI | InChI=1S/2C31H27NO3.Zn/c2*33-31(34)20-13-24-12-19-30-29(21-24)25(14-11-23-7-3-1-4-8-23)22-32(30)26-15-17-28(18-16-26)35-27-9-5-2-6-10-27;/h2*1-10,12,15-19,21-22H,11,13-14,20H2,(H,33,34);/q;;+2/p-2 |
| InChIKey | SYFCTGBJULTMRD-UHFFFAOYSA-L |
| XLogP | 11.78 |
| TPSA | 108.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 986.50 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|