C26H13F11O3S2 — CID 87483034
[phenyl-bis[4-(trifluoromethyl)phenyl]-λ4-sulfanyl] 2,3,4,5,6-pentafluorobenzenesulfonate (PubChem CID 87483034) has the molecular formula C26H13F11O3S2 and a molecular weight of 646.50 g/mol. Its IUPAC name is [phenyl-bis[4-(trifluoromethyl)phenyl]-λ4-sulfanyl] 2,3,4,5,6-pentafluorobenzenesulfonate.
| Compound Name | [phenyl-bis[4-(trifluoromethyl)phenyl]-λ4-sulfanyl] 2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| PubChem CID | 87483034 |
| Molecular Formula | C26H13F11O3S2 |
| Molecular Weight | 646.50 g/mol |
| Exact Mass | 646.01 |
| IUPAC Name | [phenyl-bis[4-(trifluoromethyl)phenyl]-λ4-sulfanyl] 2,3,4,5,6-pentafluorobenzenesulfonate |
| SMILES | O=S(=O)(OS(c1ccccc1)(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C26H13F11O3S2/c27-19-20(28)22(30)24(23(31)21(19)29)42(38,39)40-41(16-4-2-1-3-5-16,17-10-6-14(7-11-17)25(32,33)34)18-12-8-15(9-13-18)26(35,36)37/h1-13H |
| InChIKey | CNDISCMAELFALX-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.50 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|