C7F12O — CID 87483460
1,2,3,3,4,4,5,5,5-nonafluoro-1-(1,2,2-trifluoroethenoxy)pent-1-ene (PubChem CID 87483460) has the molecular formula C7F12O and a molecular weight of 328.05 g/mol. Its IUPAC name is 1,2,3,3,4,4,5,5,5-nonafluoro-1-(1,2,2-trifluoroethenoxy)pent-1-ene.
| Compound Name | 1,2,3,3,4,4,5,5,5-nonafluoro-1-(1,2,2-trifluoroethenoxy)pent-1-ene |
|---|---|
| PubChem CID | 87483460 |
| Molecular Formula | C7F12O |
| Molecular Weight | 328.05 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | 1,2,3,3,4,4,5,5,5-nonafluoro-1-(1,2,2-trifluoroethenoxy)pent-1-ene |
| SMILES | FC(F)=C(F)OC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7F12O/c8-1(3(11)20-4(12)2(9)10)5(13,14)6(15,16)7(17,18)19 |
| InChIKey | GXSWUNSDSMJIPN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.05 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|