C22H10F15NO — CID 87483572
1-[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptoxy)phenyl]isoquinoline (PubChem CID 87483572) has the molecular formula C22H10F15NO and a molecular weight of 589.30 g/mol. Its IUPAC name is 1-[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptoxy)phenyl]isoquinoline.
| Compound Name | 1-[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptoxy)phenyl]isoquinoline |
|---|---|
| PubChem CID | 87483572 |
| Molecular Formula | C22H10F15NO |
| Molecular Weight | 589.30 g/mol |
| Exact Mass | 589.05 |
| IUPAC Name | 1-[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptoxy)phenyl]isoquinoline |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Oc1ccc(-c2nccc3ccccc23)cc1 |
| InChI | InChI=1S/C22H10F15NO/c23-16(24,17(25,26)19(29,30)21(33,34)35)18(27,28)20(31,32)22(36,37)39-13-7-5-12(6-8-13)15-14-4-2-1-3-11(14)9-10-38-15/h1-10H |
| InChIKey | QXOLSTNUTMZWBD-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.30 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|