C19H21F2NO2S — CID 87484217
(6R)-6-[(E,3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-1-(4-sulfanylbut-2-ynyl)piperidin-2-one (PubChem CID 87484217) has the molecular formula C19H21F2NO2S and a molecular weight of 365.45 g/mol. Its IUPAC name is (6R)-6-[(E,3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-1-(4-sulfanylbut-2-ynyl)piperidin-2-one.
| Compound Name | (6R)-6-[(E,3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-1-(4-sulfanylbut-2-ynyl)piperidin-2-one |
|---|---|
| PubChem CID | 87484217 |
| Molecular Formula | C19H21F2NO2S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | (6R)-6-[(E,3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-1-(4-sulfanylbut-2-ynyl)piperidin-2-one |
| SMILES | O=C1CCC[C@H](/C=C/[C@@H](O)C(F)(F)c2ccccc2)N1CC#CCS |
| InChI | InChI=1S/C19H21F2NO2S/c20-19(21,15-7-2-1-3-8-15)17(23)12-11-16-9-6-10-18(24)22(16)13-4-5-14-25/h1-3,7-8,11-12,16-17,23,25H,6,9-10,13-14H2/b12-11+/t16-,17-/m1/s1 |
| InChIKey | FWBSSXZRZFZDAM-CSLLIFPHSA-N |
| XLogP | 3.01 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|