C24H24F3N3O5S — CID 87484413
2-amino-2-(hydroxymethyl)propane-1,3-diol;1,10-phenanthroline;2,2,4-trifluoro-1-thiophen-2-ylbutane-1,3-dione (PubChem CID 87484413) has the molecular formula C24H24F3N3O5S and a molecular weight of 523.53 g/mol. Its IUPAC name is 2-amino-2-(hydroxymethyl)propane-1,3-diol;1,10-phenanthroline;2,2,4-trifluoro-1-thiophen-2-ylbutane-1,3-dione.
| Compound Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;1,10-phenanthroline;2,2,4-trifluoro-1-thiophen-2-ylbutane-1,3-dione |
|---|---|
| PubChem CID | 87484413 |
| Molecular Formula | C24H24F3N3O5S |
| Molecular Weight | 523.53 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;1,10-phenanthroline;2,2,4-trifluoro-1-thiophen-2-ylbutane-1,3-dione |
| SMILES | NC(CO)(CO)CO.O=C(CF)C(F)(F)C(=O)c1cccs1.c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.C8H5F3O2S.C4H11NO3/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;9-4-6(12)8(10,11)7(13)5-2-1-3-14-5;5-4(1-6,2-7)3-8/h1-8H;1-3H,4H2;6-8H,1-3,5H2 |
| InChIKey | PLNSKYAGEPPBOV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 146.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.53 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|