About [(4-fluorophenyl)-diphenyl-λ4-sulfanyl] perchlorate
[(4-fluorophenyl)-diphenyl-λ4-sulfanyl] perchlorate (PubChem CID 87484643) has the molecular formula C18H14ClFO4S
and a molecular weight of 380.82 g/mol. Its IUPAC name is [(4-fluorophenyl)-diphenyl-λ4-sulfanyl] perchlorate.
Molecular Properties
| Compound Name | [(4-fluorophenyl)-diphenyl-λ4-sulfanyl] perchlorate |
| PubChem CID | 87484643 |
| Molecular Formula | C18H14ClFO4S |
| Molecular Weight | 380.82 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | [(4-fluorophenyl)-diphenyl-λ4-sulfanyl] perchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])OS(c1ccccc1)(c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H14ClFO4S/c20-15-11-13-18(14-12-15)25(24-19(21,22)23,16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14H |
| InChIKey | CBJDEOKCKKEHCE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 78.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.82 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(4-fluorophenyl)-diphenyl-λ4-sulfanyl] perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-fluorophenyl)-diphenyl-λ4-sulfanyl] perchlorate?
The IUPAC name of [(4-fluorophenyl)-diphenyl-λ4-sulfanyl] perchlorate (CID 87484643) is [(4-fluorophenyl)-diphenyl-λ4-sulfanyl] perchlorate.
What is the SMILES notation for [(4-fluorophenyl)-diphenyl-λ4-sulfanyl] perchlorate?
The canonical SMILES for [(4-fluorophenyl)-diphenyl-λ4-sulfanyl] perchlorate is [O-][Cl+3]([O-])([O-])OS(c1ccccc1)(c1ccccc1)c1ccc(F)cc1.
What is the InChIKey of [(4-fluorophenyl)-diphenyl-λ4-sulfanyl] perchlorate?
The InChIKey is CBJDEOKCKKEHCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14ClFO4S/c20-15-11-13-18(14-12-15)25(24-19(21,22)23,16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14H.
What are the key properties of [(4-fluorophenyl)-diphenyl-λ4-sulfanyl] perchlorate?
[(4-fluorophenyl)-diphenyl-λ4-sulfanyl] perchlorate has a molecular weight of 380.82 g/mol, XLogP of 1.94, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-fluorophenyl)-diphenyl-λ4-sulfanyl] perchlorate is sourced from PubChem (CID 87484643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).