About [(4-butoxyphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate
[(4-butoxyphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate (PubChem CID 87484717) has the molecular formula C29H27F3O4S2
and a molecular weight of 560.66 g/mol. Its IUPAC name is [(4-butoxyphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate.
Molecular Properties
| Compound Name | [(4-butoxyphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate |
| PubChem CID | 87484717 |
| Molecular Formula | C29H27F3O4S2 |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.13 |
| IUPAC Name | [(4-butoxyphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate |
| SMILES | CCCCOc1ccc(S(OS(=O)(=O)c2ccc(C(F)(F)F)cc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H27F3O4S2/c1-2-3-22-35-24-16-20-27(21-17-24)37(25-10-6-4-7-11-25,26-12-8-5-9-13-26)36-38(33,34)28-18-14-23(15-19-28)29(30,31)32/h4-21H,2-3,22H2,1H3 |
| InChIKey | RWLNDSMXXLPORL-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(4-butoxyphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-butoxyphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate?
The IUPAC name of [(4-butoxyphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate (CID 87484717) is [(4-butoxyphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate.
What is the SMILES notation for [(4-butoxyphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate?
The canonical SMILES for [(4-butoxyphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate is CCCCOc1ccc(S(OS(=O)(=O)c2ccc(C(F)(F)F)cc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of [(4-butoxyphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate?
The InChIKey is RWLNDSMXXLPORL-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H27F3O4S2/c1-2-3-22-35-24-16-20-27(21-17-24)37(25-10-6-4-7-11-25,26-12-8-5-9-13-26)36-38(33,34)28-18-14-23(15-19-28)29(30,31)32/h4-21H,2-3,22H2,1H3.
What are the key properties of [(4-butoxyphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate?
[(4-butoxyphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate has a molecular weight of 560.66 g/mol, XLogP of 8.49, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-butoxyphenyl)-diphenyl-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate is sourced from PubChem (CID 87484717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).