C12H12F2O4 — CID 87484942
2-[3,4-difluoro-2-[[(2R)-2-methyloxiran-2-yl]methoxy]phenyl]acetic acid (PubChem CID 87484942) has the molecular formula C12H12F2O4 and a molecular weight of 258.22 g/mol. Its IUPAC name is 2-[3,4-difluoro-2-[[(2R)-2-methyloxiran-2-yl]methoxy]phenyl]acetic acid.
| Compound Name | 2-[3,4-difluoro-2-[[(2R)-2-methyloxiran-2-yl]methoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 87484942 |
| Molecular Formula | C12H12F2O4 |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 2-[3,4-difluoro-2-[[(2R)-2-methyloxiran-2-yl]methoxy]phenyl]acetic acid |
| SMILES | C[C@]1(COc2c(CC(=O)O)ccc(F)c2F)CO1 |
| InChI | InChI=1S/C12H12F2O4/c1-12(6-18-12)5-17-11-7(4-9(15)16)2-3-8(13)10(11)14/h2-3H,4-6H2,1H3,(H,15,16)/t12-/m0/s1 |
| InChIKey | ZDGMOECSKYFTIN-LBPRGKRZSA-N |
| XLogP | 1.76 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|