C15H15NO — CID 87485232
4-ethynyl-1-methyl-3-methylidenepyrrolidin-2-one;3-methylbicyclo[3.1.0]hexa-1(6),2,4-triene (PubChem CID 87485232) has the molecular formula C15H15NO and a molecular weight of 225.29 g/mol. Its IUPAC name is 4-ethynyl-1-methyl-3-methylidenepyrrolidin-2-one;3-methylbicyclo[3.1.0]hexa-1(6),2,4-triene.
| Compound Name | 4-ethynyl-1-methyl-3-methylidenepyrrolidin-2-one;3-methylbicyclo[3.1.0]hexa-1(6),2,4-triene |
|---|---|
| PubChem CID | 87485232 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 4-ethynyl-1-methyl-3-methylidenepyrrolidin-2-one;3-methylbicyclo[3.1.0]hexa-1(6),2,4-triene |
| SMILES | C#CC1CN(C)C(=O)C1=C.Cc1cc2cc-2c1 |
| InChI | InChI=1S/C8H9NO.C7H6/c1-4-7-5-9(3)8(10)6(7)2;1-5-2-6-4-7(6)3-5/h1,7H,2,5H2,3H3;2-4H,1H3 |
| InChIKey | QUBUWTFSZRBKRK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|