C21H33F5GeO7Si — CID 87485337
triethoxy-(2,3,4,5,6-pentafluorophenyl)germane;1-triethoxysilylprop-2-en-1-one (PubChem CID 87485337) has the molecular formula C21H33F5GeO7Si and a molecular weight of 593.17 g/mol. Its IUPAC name is triethoxy-(2,3,4,5,6-pentafluorophenyl)germane;1-triethoxysilylprop-2-en-1-one.
| Compound Name | triethoxy-(2,3,4,5,6-pentafluorophenyl)germane;1-triethoxysilylprop-2-en-1-one |
|---|---|
| PubChem CID | 87485337 |
| Molecular Formula | C21H33F5GeO7Si |
| Molecular Weight | 593.17 g/mol |
| Exact Mass | 594.11 |
| IUPAC Name | triethoxy-(2,3,4,5,6-pentafluorophenyl)germane;1-triethoxysilylprop-2-en-1-one |
| SMILES | C=CC(=O)[Si](OCC)(OCC)OCC.CCO[Ge](OCC)(OCC)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H15F5GeO3.C9H18O4Si/c1-4-19-18(20-5-2,21-6-3)12-10(16)8(14)7(13)9(15)11(12)17;1-5-9(10)14(11-6-2,12-7-3)13-8-4/h4-6H2,1-3H3;5H,1,6-8H2,2-4H3 |
| InChIKey | QYALMOZMCWSZBM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.17 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|