About 2-cyclohexyl-1-phenyl-1,2,4-triazolidine-3-thione
2-cyclohexyl-1-phenyl-1,2,4-triazolidine-3-thione (PubChem CID 87485377) has the molecular formula C14H19N3S
and a molecular weight of 261.39 g/mol. Its IUPAC name is 2-cyclohexyl-1-phenyl-1,2,4-triazolidine-3-thione.
Molecular Properties
| Compound Name | 2-cyclohexyl-1-phenyl-1,2,4-triazolidine-3-thione |
| PubChem CID | 87485377 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2-cyclohexyl-1-phenyl-1,2,4-triazolidine-3-thione |
| SMILES | S=C1NCN(c2ccccc2)N1C1CCCCC1 |
| InChI | InChI=1S/C14H19N3S/c18-14-15-11-16(12-7-3-1-4-8-12)17(14)13-9-5-2-6-10-13/h1,3-4,7-8,13H,2,5-6,9-11H2,(H,15,18) |
| InChIKey | ANXQLJZSLRDROZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyl-1-phenyl-1,2,4-triazolidine-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-1-phenyl-1,2,4-triazolidine-3-thione?
The IUPAC name of 2-cyclohexyl-1-phenyl-1,2,4-triazolidine-3-thione (CID 87485377) is 2-cyclohexyl-1-phenyl-1,2,4-triazolidine-3-thione.
What is the SMILES notation for 2-cyclohexyl-1-phenyl-1,2,4-triazolidine-3-thione?
The canonical SMILES for 2-cyclohexyl-1-phenyl-1,2,4-triazolidine-3-thione is S=C1NCN(c2ccccc2)N1C1CCCCC1.
What is the InChIKey of 2-cyclohexyl-1-phenyl-1,2,4-triazolidine-3-thione?
The InChIKey is ANXQLJZSLRDROZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3S/c18-14-15-11-16(12-7-3-1-4-8-12)17(14)13-9-5-2-6-10-13/h1,3-4,7-8,13H,2,5-6,9-11H2,(H,15,18).
What are the key properties of 2-cyclohexyl-1-phenyl-1,2,4-triazolidine-3-thione?
2-cyclohexyl-1-phenyl-1,2,4-triazolidine-3-thione has a molecular weight of 261.39 g/mol, XLogP of 2.89, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-1-phenyl-1,2,4-triazolidine-3-thione is sourced from PubChem (CID 87485377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).