About 1-phenyl-2-[4-(trifluoromethyl)phenyl]-1,2,4-triazolidine-3-thiol
1-phenyl-2-[4-(trifluoromethyl)phenyl]-1,2,4-triazolidine-3-thiol (PubChem CID 87485549) has the molecular formula C15H14F3N3S
and a molecular weight of 325.36 g/mol. Its IUPAC name is 1-phenyl-2-[4-(trifluoromethyl)phenyl]-1,2,4-triazolidine-3-thiol.
Molecular Properties
| Compound Name | 1-phenyl-2-[4-(trifluoromethyl)phenyl]-1,2,4-triazolidine-3-thiol |
| PubChem CID | 87485549 |
| Molecular Formula | C15H14F3N3S |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 1-phenyl-2-[4-(trifluoromethyl)phenyl]-1,2,4-triazolidine-3-thiol |
| SMILES | FC(F)(F)c1ccc(N2C(S)NCN2c2ccccc2)cc1 |
| InChI | InChI=1S/C15H14F3N3S/c16-15(17,18)11-6-8-13(9-7-11)21-14(22)19-10-20(21)12-4-2-1-3-5-12/h1-9,14,19,22H,10H2 |
| InChIKey | HYGZWUYUWJZRGC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-2-[4-(trifluoromethyl)phenyl]-1,2,4-triazolidine-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-2-[4-(trifluoromethyl)phenyl]-1,2,4-triazolidine-3-thiol?
The IUPAC name of 1-phenyl-2-[4-(trifluoromethyl)phenyl]-1,2,4-triazolidine-3-thiol (CID 87485549) is 1-phenyl-2-[4-(trifluoromethyl)phenyl]-1,2,4-triazolidine-3-thiol.
What is the SMILES notation for 1-phenyl-2-[4-(trifluoromethyl)phenyl]-1,2,4-triazolidine-3-thiol?
The canonical SMILES for 1-phenyl-2-[4-(trifluoromethyl)phenyl]-1,2,4-triazolidine-3-thiol is FC(F)(F)c1ccc(N2C(S)NCN2c2ccccc2)cc1.
What is the InChIKey of 1-phenyl-2-[4-(trifluoromethyl)phenyl]-1,2,4-triazolidine-3-thiol?
The InChIKey is HYGZWUYUWJZRGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F3N3S/c16-15(17,18)11-6-8-13(9-7-11)21-14(22)19-10-20(21)12-4-2-1-3-5-12/h1-9,14,19,22H,10H2.
What are the key properties of 1-phenyl-2-[4-(trifluoromethyl)phenyl]-1,2,4-triazolidine-3-thiol?
1-phenyl-2-[4-(trifluoromethyl)phenyl]-1,2,4-triazolidine-3-thiol has a molecular weight of 325.36 g/mol, XLogP of 3.71, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-2-[4-(trifluoromethyl)phenyl]-1,2,4-triazolidine-3-thiol is sourced from PubChem (CID 87485549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).