C19H36O3 — CID 87486181
(Z)-3-butyl-3-[(Z)-hex-3-enyl]non-6-ene-1,1,1-triol (PubChem CID 87486181) has the molecular formula C19H36O3 and a molecular weight of 312.49 g/mol. Its IUPAC name is (Z)-3-butyl-3-[(Z)-hex-3-enyl]non-6-ene-1,1,1-triol.
| Compound Name | (Z)-3-butyl-3-[(Z)-hex-3-enyl]non-6-ene-1,1,1-triol |
|---|---|
| PubChem CID | 87486181 |
| Molecular Formula | C19H36O3 |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.27 |
| IUPAC Name | (Z)-3-butyl-3-[(Z)-hex-3-enyl]non-6-ene-1,1,1-triol |
| SMILES | CC/C=C\CCC(CC/C=C\CC)(CCCC)CC(O)(O)O |
| InChI | InChI=1S/C19H36O3/c1-4-7-10-12-15-18(14-9-6-3,17-19(20,21)22)16-13-11-8-5-2/h7-8,10-11,20-22H,4-6,9,12-17H2,1-3H3/b10-7-,11-8- |
| InChIKey | QAXZRUVLTPOKTQ-DEFDFUCDSA-N |
| XLogP | 4.68 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|