C9H18BNaO4 — CID 87486221
sodium 2,2,3,3-tetramethyl-1,4,7,10-tetraoxa-5-boranuidaspiro[4.5]decane (PubChem CID 87486221) has the molecular formula C9H18BNaO4 and a molecular weight of 224.04 g/mol. Its IUPAC name is sodium 2,2,3,3-tetramethyl-1,4,7,10-tetraoxa-5-boranuidaspiro[4.5]decane.
| Compound Name | sodium 2,2,3,3-tetramethyl-1,4,7,10-tetraoxa-5-boranuidaspiro[4.5]decane |
|---|---|
| PubChem CID | 87486221 |
| Molecular Formula | C9H18BNaO4 |
| Molecular Weight | 224.04 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | sodium 2,2,3,3-tetramethyl-1,4,7,10-tetraoxa-5-boranuidaspiro[4.5]decane |
| SMILES | CC1(C)O[B-]2(COCCO2)OC1(C)C.[Na+] |
| InChI | InChI=1S/C9H18BO4.Na/c1-8(2)9(3,4)14-10(13-8)7-11-5-6-12-10;/h5-7H2,1-4H3;/q-1;+1 |
| InChIKey | WBAKACQJACEKBB-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.04 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|