About octa-1,3,5-trien-3-ol
octa-1,3,5-trien-3-ol (PubChem CID 87486401) has the molecular formula C8H12O
and a molecular weight of 124.18 g/mol. Its IUPAC name is octa-1,3,5-trien-3-ol.
Molecular Properties
| Compound Name | octa-1,3,5-trien-3-ol |
| PubChem CID | 87486401 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | octa-1,3,5-trien-3-ol |
| SMILES | C=CC(O)=CC=CCC |
| InChI | InChI=1S/C8H12O/c1-3-5-6-7-8(9)4-2/h4-7,9H,2-3H2,1H3 |
| InChIKey | FITOZQVMAXTGNJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze octa-1,3,5-trien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octa-1,3,5-trien-3-ol?
The IUPAC name of octa-1,3,5-trien-3-ol (CID 87486401) is octa-1,3,5-trien-3-ol.
What is the SMILES notation for octa-1,3,5-trien-3-ol?
The canonical SMILES for octa-1,3,5-trien-3-ol is C=CC(O)=CC=CCC.
What is the InChIKey of octa-1,3,5-trien-3-ol?
The InChIKey is FITOZQVMAXTGNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O/c1-3-5-6-7-8(9)4-2/h4-7,9H,2-3H2,1H3.
What are the key properties of octa-1,3,5-trien-3-ol?
octa-1,3,5-trien-3-ol has a molecular weight of 124.18 g/mol, XLogP of 2.58, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for octa-1,3,5-trien-3-ol is sourced from PubChem (CID 87486401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).