About 1-methylquinolizin-4-one
1-methylquinolizin-4-one (PubChem CID 87486754) has the molecular formula C10H9NO
and a molecular weight of 159.19 g/mol. Its IUPAC name is 1-methylquinolizin-4-one.
Molecular Properties
| Compound Name | 1-methylquinolizin-4-one |
| PubChem CID | 87486754 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 1-methylquinolizin-4-one |
| SMILES | Cc1ccc(=O)n2ccccc12 |
| InChI | InChI=1S/C10H9NO/c1-8-5-6-10(12)11-7-3-2-4-9(8)11/h2-7H,1H3 |
| InChIKey | OWAWJOLJIQEJRJ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 21.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methylquinolizin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylquinolizin-4-one?
The IUPAC name of 1-methylquinolizin-4-one (CID 87486754) is 1-methylquinolizin-4-one.
What is the SMILES notation for 1-methylquinolizin-4-one?
The canonical SMILES for 1-methylquinolizin-4-one is Cc1ccc(=O)n2ccccc12.
What is the InChIKey of 1-methylquinolizin-4-one?
The InChIKey is OWAWJOLJIQEJRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO/c1-8-5-6-10(12)11-7-3-2-4-9(8)11/h2-7H,1H3.
What are the key properties of 1-methylquinolizin-4-one?
1-methylquinolizin-4-one has a molecular weight of 159.19 g/mol, XLogP of 1.61, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylquinolizin-4-one is sourced from PubChem (CID 87486754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).