C23H44O3Si2 — CID 87486896
(4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]oct-7-yn-3-one (PubChem CID 87486896) has the molecular formula C23H44O3Si2 and a molecular weight of 424.77 g/mol. Its IUPAC name is (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]oct-7-yn-3-one.
| Compound Name | (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]oct-7-yn-3-one |
|---|---|
| PubChem CID | 87486896 |
| Molecular Formula | C23H44O3Si2 |
| Molecular Weight | 424.77 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]oct-7-yn-3-one |
| SMILES | C#CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C(=O)CC)[C@H](C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H44O3Si2/c1-14-17-20(26-28(12,13)23(7,8)9)21(18(24)15-2)19(16-3)25-27(10,11)22(4,5)6/h1,16,19-21H,3,15,17H2,2,4-13H3/t19-,20+,21-/m0/s1 |
| InChIKey | YPTRPHLSRSXOIN-HBMCJLEFSA-N |
| XLogP | 6.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.77 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|