C23H46O2Si2 — CID 87486925
tert-butyl-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethenyl-2-propylhex-5-ynoxy]-dimethylsilane (PubChem CID 87486925) has the molecular formula C23H46O2Si2 and a molecular weight of 410.79 g/mol. Its IUPAC name is tert-butyl-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethenyl-2-propylhex-5-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethenyl-2-propylhex-5-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 87486925 |
| Molecular Formula | C23H46O2Si2 |
| Molecular Weight | 410.79 g/mol |
| Exact Mass | 410.30 |
| IUPAC Name | tert-butyl-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethenyl-2-propylhex-5-ynoxy]-dimethylsilane |
| SMILES | C#CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CCC)[C@H](C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H46O2Si2/c1-14-17-19(20(16-3)24-26(10,11)22(4,5)6)21(18-15-2)25-27(12,13)23(7,8)9/h2,16,19-21H,3,14,17-18H2,1,4-13H3/t19-,20-,21+/m0/s1 |
| InChIKey | JEMWYQANOCDMKM-PCCBWWKXSA-N |
| XLogP | 7.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.79 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|